C20H16N4O2 — CID 3393683
3-[[1-(3-methylphenyl)pyrrol-2-yl]methylideneamino]-1H-quinazoline-2,4-dione (PubChem CID 3393683) has the molecular formula C20H16N4O2 and a molecular weight of 344.37 g/mol. Its IUPAC name is 3-[[1-(3-methylphenyl)pyrrol-2-yl]methylideneamino]-1H-quinazoline-2,4-dione.
| Compound Name | 3-[[1-(3-methylphenyl)pyrrol-2-yl]methylideneamino]-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 3393683 |
| Molecular Formula | C20H16N4O2 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 3-[[1-(3-methylphenyl)pyrrol-2-yl]methylideneamino]-1H-quinazoline-2,4-dione |
| SMILES | Cc1cccc(-n2cccc2C=Nn2c(=O)[nH]c3ccccc3c2=O)c1 |
| InChI | InChI=1S/C20H16N4O2/c1-14-6-4-7-15(12-14)23-11-5-8-16(23)13-21-24-19(25)17-9-2-3-10-18(17)22-20(24)26/h2-13H,1H3,(H,22,26) |
| InChIKey | WHGWSWUWQXHWQI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 72.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|