C15H14N4O3 — CID 3888838
3-[[5-(dimethylamino)furan-2-yl]methylideneamino]-1H-quinazoline-2,4-dione (PubChem CID 3888838) has the molecular formula C15H14N4O3 and a molecular weight of 298.30 g/mol. Its IUPAC name is 3-[[5-(dimethylamino)furan-2-yl]methylideneamino]-1H-quinazoline-2,4-dione.
| Compound Name | 3-[[5-(dimethylamino)furan-2-yl]methylideneamino]-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 3888838 |
| Molecular Formula | C15H14N4O3 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 3-[[5-(dimethylamino)furan-2-yl]methylideneamino]-1H-quinazoline-2,4-dione |
| SMILES | CN(C)c1ccc(C=Nn2c(=O)[nH]c3ccccc3c2=O)o1 |
| InChI | InChI=1S/C15H14N4O3/c1-18(2)13-8-7-10(22-13)9-16-19-14(20)11-5-3-4-6-12(11)17-15(19)21/h3-9H,1-2H3,(H,17,21) |
| InChIKey | KGZXTOUEONHSCP-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|