C21H16N4O6S — CID 4652855
N-[4-[5-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]furan-2-yl]phenyl]sulfonylacetamide (PubChem CID 4652855) has the molecular formula C21H16N4O6S and a molecular weight of 452.45 g/mol. Its IUPAC name is N-[4-[5-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]furan-2-yl]phenyl]sulfonylacetamide.
| Compound Name | N-[4-[5-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]furan-2-yl]phenyl]sulfonylacetamide |
|---|---|
| PubChem CID | 4652855 |
| Molecular Formula | C21H16N4O6S |
| Molecular Weight | 452.45 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | N-[4-[5-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]furan-2-yl]phenyl]sulfonylacetamide |
| SMILES | CC(=O)NS(=O)(=O)c1ccc(-c2ccc(C=Nn3c(=O)[nH]c4ccccc4c3=O)o2)cc1 |
| InChI | InChI=1S/C21H16N4O6S/c1-13(26)24-32(29,30)16-9-6-14(7-10-16)19-11-8-15(31-19)12-22-25-20(27)17-4-2-3-5-18(17)23-21(25)28/h2-12H,1H3,(H,23,28)(H,24,26) |
| InChIKey | CJLQRKNAUMDPLR-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 143.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.45 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|