C24H21N3O6S — CID 46499397
N-[4-[5-[(Z)-[1-(4-ethylphenyl)-3,5-dioxopyrazolidin-4-ylidene]methyl]furan-2-yl]phenyl]sulfonylacetamide (PubChem CID 46499397) has the molecular formula C24H21N3O6S and a molecular weight of 479.51 g/mol. Its IUPAC name is N-[4-[5-[(Z)-[1-(4-ethylphenyl)-3,5-dioxopyrazolidin-4-ylidene]methyl]furan-2-yl]phenyl]sulfonylacetamide.
| Compound Name | N-[4-[5-[(Z)-[1-(4-ethylphenyl)-3,5-dioxopyrazolidin-4-ylidene]methyl]furan-2-yl]phenyl]sulfonylacetamide |
|---|---|
| PubChem CID | 46499397 |
| Molecular Formula | C24H21N3O6S |
| Molecular Weight | 479.51 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | N-[4-[5-[(Z)-[1-(4-ethylphenyl)-3,5-dioxopyrazolidin-4-ylidene]methyl]furan-2-yl]phenyl]sulfonylacetamide |
| SMILES | CCc1ccc(N2NC(=O)/C(=C/c3ccc(-c4ccc(S(=O)(=O)NC(C)=O)cc4)o3)C2=O)cc1 |
| InChI | InChI=1S/C24H21N3O6S/c1-3-16-4-8-18(9-5-16)27-24(30)21(23(29)25-27)14-19-10-13-22(33-19)17-6-11-20(12-7-17)34(31,32)26-15(2)28/h4-14H,3H2,1-2H3,(H,25,29)(H,26,28)/b21-14- |
| InChIKey | VSKDIJSFXCKKJU-STZFKDTASA-N |
| XLogP | 2.80 |
| TPSA | 125.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.51 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|