C36H27N5O5 — CID 126307980
2-(1-benzofuran-2-yl)-3-[[2,5-dimethyl-1-[4-[(3-nitrophenyl)methoxy]phenyl]pyrrol-3-yl]methylideneamino]quinazolin-4-one (PubChem CID 126307980) has the molecular formula C36H27N5O5 and a molecular weight of 609.64 g/mol. Its IUPAC name is 2-(1-benzofuran-2-yl)-3-[[2,5-dimethyl-1-[4-[(3-nitrophenyl)methoxy]phenyl]pyrrol-3-yl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-(1-benzofuran-2-yl)-3-[[2,5-dimethyl-1-[4-[(3-nitrophenyl)methoxy]phenyl]pyrrol-3-yl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126307980 |
| Molecular Formula | C36H27N5O5 |
| Molecular Weight | 609.64 g/mol |
| Exact Mass | 609.20 |
| IUPAC Name | 2-(1-benzofuran-2-yl)-3-[[2,5-dimethyl-1-[4-[(3-nitrophenyl)methoxy]phenyl]pyrrol-3-yl]methylideneamino]quinazolin-4-one |
| SMILES | Cc1cc(C=Nn2c(-c3cc4ccccc4o3)nc3ccccc3c2=O)c(C)n1-c1ccc(OCc2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C36H27N5O5/c1-23-18-27(24(2)39(23)28-14-16-30(17-15-28)45-22-25-8-7-10-29(19-25)41(43)44)21-37-40-35(34-20-26-9-3-6-13-33(26)46-34)38-32-12-5-4-11-31(32)36(40)42/h3-21H,22H2,1-2H3 |
| InChIKey | BHXAPIQABBXIHL-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 117.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.64 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|