C30H20F4N4O3 — CID 126308194
N-(4-fluorophenyl)-2-[2-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]acetamide (PubChem CID 126308194) has the molecular formula C30H20F4N4O3 and a molecular weight of 560.51 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[2-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[2-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126308194 |
| Molecular Formula | C30H20F4N4O3 |
| Molecular Weight | 560.51 g/mol |
| Exact Mass | 560.15 |
| IUPAC Name | N-(4-fluorophenyl)-2-[2-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]acetamide |
| SMILES | O=C(COc1ccccc1C=Nn1c(-c2cccc(C(F)(F)F)c2)nc2ccccc2c1=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C30H20F4N4O3/c31-22-12-14-23(15-13-22)36-27(39)18-41-26-11-4-1-6-20(26)17-35-38-28(19-7-5-8-21(16-19)30(32,33)34)37-25-10-3-2-9-24(25)29(38)40/h1-17H,18H2,(H,36,39) |
| InChIKey | DZSVJSNERUKIRD-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 85.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.51 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|