C25H18F3I2N3O2 — CID 126290708
3-[(3,5-diiodo-4-propan-2-yloxyphenyl)methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one (PubChem CID 126290708) has the molecular formula C25H18F3I2N3O2 and a molecular weight of 703.24 g/mol. Its IUPAC name is 3-[(3,5-diiodo-4-propan-2-yloxyphenyl)methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one.
| Compound Name | 3-[(3,5-diiodo-4-propan-2-yloxyphenyl)methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 126290708 |
| Molecular Formula | C25H18F3I2N3O2 |
| Molecular Weight | 703.24 g/mol |
| Exact Mass | 702.94 |
| IUPAC Name | 3-[(3,5-diiodo-4-propan-2-yloxyphenyl)methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
| SMILES | CC(C)Oc1c(I)cc(C=Nn2c(-c3cccc(C(F)(F)F)c3)nc3ccccc3c2=O)cc1I |
| InChI | InChI=1S/C25H18F3I2N3O2/c1-14(2)35-22-19(29)10-15(11-20(22)30)13-31-33-23(16-6-5-7-17(12-16)25(26,27)28)32-21-9-4-3-8-18(21)24(33)34/h3-14H,1-2H3 |
| InChIKey | LRVJCFWGFBQAQP-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.24 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|