C35H31BrN4O7 — CID 126296632
3-[[2-(1,3-benzodioxol-5-ylmethoxy)-5-bromo-3-nitrophenyl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one (PubChem CID 126296632) has the molecular formula C35H31BrN4O7 and a molecular weight of 699.56 g/mol. Its IUPAC name is 3-[[2-(1,3-benzodioxol-5-ylmethoxy)-5-bromo-3-nitrophenyl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one.
| Compound Name | 3-[[2-(1,3-benzodioxol-5-ylmethoxy)-5-bromo-3-nitrophenyl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 126296632 |
| Molecular Formula | C35H31BrN4O7 |
| Molecular Weight | 699.56 g/mol |
| Exact Mass | 698.14 |
| IUPAC Name | 3-[[2-(1,3-benzodioxol-5-ylmethoxy)-5-bromo-3-nitrophenyl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
| SMILES | CCOc1cc(C)c(-c2nc3ccccc3c(=O)n2N=Cc2cc(Br)cc([N+](=O)[O-])c2OCc2ccc3c(c2)OCO3)cc1C(C)C |
| InChI | InChI=1S/C35H31BrN4O7/c1-5-44-31-12-21(4)27(16-26(31)20(2)3)34-38-28-9-7-6-8-25(28)35(41)39(34)37-17-23-14-24(36)15-29(40(42)43)33(23)45-18-22-10-11-30-32(13-22)47-19-46-30/h6-17,20H,5,18-19H2,1-4H3 |
| InChIKey | TXANJPUCNRVJNR-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 127.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.56 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|