C31H25N5O6 — CID 126408823
2-[2-ethoxy-6-nitro-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]-N-phenylacetamide (PubChem CID 126408823) has the molecular formula C31H25N5O6 and a molecular weight of 563.57 g/mol. Its IUPAC name is 2-[2-ethoxy-6-nitro-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]-N-phenylacetamide.
| Compound Name | 2-[2-ethoxy-6-nitro-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 126408823 |
| Molecular Formula | C31H25N5O6 |
| Molecular Weight | 563.57 g/mol |
| Exact Mass | 563.18 |
| IUPAC Name | 2-[2-ethoxy-6-nitro-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]-N-phenylacetamide |
| SMILES | CCOc1cc(C=Nn2c(-c3ccccc3)nc3ccccc3c2=O)cc([N+](=O)[O-])c1OCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C31H25N5O6/c1-2-41-27-18-21(17-26(36(39)40)29(27)42-20-28(37)33-23-13-7-4-8-14-23)19-32-35-30(22-11-5-3-6-12-22)34-25-16-10-9-15-24(25)31(35)38/h3-19H,2,20H2,1H3,(H,33,37) |
| InChIKey | KQNLDUQDCYPPKA-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 137.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.57 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|