C31H34N4O5 — CID 126282036
3-[[4-[(2R)-butan-2-yl]oxy-3-nitrophenyl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one (PubChem CID 126282036) has the molecular formula C31H34N4O5 and a molecular weight of 542.64 g/mol. Its IUPAC name is 3-[[4-[(2R)-butan-2-yl]oxy-3-nitrophenyl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one.
| Compound Name | 3-[[4-[(2R)-butan-2-yl]oxy-3-nitrophenyl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 126282036 |
| Molecular Formula | C31H34N4O5 |
| Molecular Weight | 542.64 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | 3-[[4-[(2R)-butan-2-yl]oxy-3-nitrophenyl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
| SMILES | CCOc1cc(C)c(-c2nc3ccccc3c(=O)n2N=Cc2ccc(O[C@H](C)CC)c([N+](=O)[O-])c2)cc1C(C)C |
| InChI | InChI=1S/C31H34N4O5/c1-7-21(6)40-28-14-13-22(16-27(28)35(37)38)18-32-34-30(33-26-12-10-9-11-23(26)31(34)36)25-17-24(19(3)4)29(39-8-2)15-20(25)5/h9-19,21H,7-8H2,1-6H3/t21-/m1/s1 |
| InChIKey | MIKDDEZNDLZIDO-OAQYLSRUSA-N |
| XLogP | 6.86 |
| TPSA | 108.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.64 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|