C26H23BrN4O5 — CID 137036419
3-[(3-bromo-4-hydroxy-5-nitrophenyl)methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one (PubChem CID 137036419) has the molecular formula C26H23BrN4O5 and a molecular weight of 551.40 g/mol. Its IUPAC name is 3-[(3-bromo-4-hydroxy-5-nitrophenyl)methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one.
| Compound Name | 3-[(3-bromo-4-hydroxy-5-nitrophenyl)methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 137036419 |
| Molecular Formula | C26H23BrN4O5 |
| Molecular Weight | 551.40 g/mol |
| Exact Mass | 550.09 |
| IUPAC Name | 3-[(3-bromo-4-hydroxy-5-nitrophenyl)methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
| SMILES | COc1cc(C)c(-c2nc3ccccc3c(=O)n2N=Cc2cc(Br)c(O)c([N+](=O)[O-])c2)cc1C(C)C |
| InChI | InChI=1S/C26H23BrN4O5/c1-14(2)18-12-19(15(3)9-23(18)36-4)25-29-21-8-6-5-7-17(21)26(33)30(25)28-13-16-10-20(27)24(32)22(11-16)31(34)35/h5-14,32H,1-4H3 |
| InChIKey | GCBYQLIOGNGYSN-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.40 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|