C28H23N3O6 — CID 126312882
(2R)-2-[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-ethoxyphenoxy]propanoic acid (PubChem CID 126312882) has the molecular formula C28H23N3O6 and a molecular weight of 497.51 g/mol. Its IUPAC name is (2R)-2-[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-ethoxyphenoxy]propanoic acid.
| Compound Name | (2R)-2-[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-ethoxyphenoxy]propanoic acid |
|---|---|
| PubChem CID | 126312882 |
| Molecular Formula | C28H23N3O6 |
| Molecular Weight | 497.51 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | (2R)-2-[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-ethoxyphenoxy]propanoic acid |
| SMILES | CCOc1cc(C=Nn2c(-c3cc4ccccc4o3)nc3ccccc3c2=O)ccc1O[C@H](C)C(=O)O |
| InChI | InChI=1S/C28H23N3O6/c1-3-35-24-14-18(12-13-23(24)36-17(2)28(33)34)16-29-31-26(25-15-19-8-4-7-11-22(19)37-25)30-21-10-6-5-9-20(21)27(31)32/h4-17H,3H2,1-2H3,(H,33,34)/t17-/m1/s1 |
| InChIKey | QQPDXKICPGMRDJ-QGZVFWFLSA-N |
| XLogP | 4.94 |
| TPSA | 116.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.51 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|