C24H14ClF3N4O2 — CID 126298514
2-[4-chloro-2-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]acetonitrile (PubChem CID 126298514) has the molecular formula C24H14ClF3N4O2 and a molecular weight of 482.85 g/mol. Its IUPAC name is 2-[4-chloro-2-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]acetonitrile.
| Compound Name | 2-[4-chloro-2-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]acetonitrile |
|---|---|
| PubChem CID | 126298514 |
| Molecular Formula | C24H14ClF3N4O2 |
| Molecular Weight | 482.85 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | 2-[4-chloro-2-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]acetonitrile |
| SMILES | N#CCOc1ccc(Cl)cc1C=Nn1c(-c2cccc(C(F)(F)F)c2)nc2ccccc2c1=O |
| InChI | InChI=1S/C24H14ClF3N4O2/c25-18-8-9-21(34-11-10-29)16(13-18)14-30-32-22(15-4-3-5-17(12-15)24(26,27)28)31-20-7-2-1-6-19(20)23(32)33/h1-9,12-14H,11H2 |
| InChIKey | GIYUZLVXMYRBLM-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 80.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.85 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|