C27H18ClN3O4 — CID 126303598
3-[(5-chloro-2-prop-2-ynoxyphenyl)methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one (PubChem CID 126303598) has the molecular formula C27H18ClN3O4 and a molecular weight of 483.91 g/mol. Its IUPAC name is 3-[(5-chloro-2-prop-2-ynoxyphenyl)methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one.
| Compound Name | 3-[(5-chloro-2-prop-2-ynoxyphenyl)methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one |
|---|---|
| PubChem CID | 126303598 |
| Molecular Formula | C27H18ClN3O4 |
| Molecular Weight | 483.91 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | 3-[(5-chloro-2-prop-2-ynoxyphenyl)methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one |
| SMILES | C#CCOc1ccc(Cl)cc1C=Nn1c(-c2cc3c(OC)cccc3o2)nc2ccccc2c1=O |
| InChI | InChI=1S/C27H18ClN3O4/c1-3-13-34-22-12-11-18(28)14-17(22)16-29-31-26(30-21-8-5-4-7-19(21)27(31)32)25-15-20-23(33-2)9-6-10-24(20)35-25/h1,4-12,14-16H,13H2,2H3 |
| InChIKey | LCSWGLMYGDUTJG-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 78.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.91 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|