C27H18BrClN4O4 — CID 126292272
2-[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-3-bromo-2-chloro-6-ethoxyphenoxy]acetonitrile (PubChem CID 126292272) has the molecular formula C27H18BrClN4O4 and a molecular weight of 577.82 g/mol. Its IUPAC name is 2-[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-3-bromo-2-chloro-6-ethoxyphenoxy]acetonitrile.
| Compound Name | 2-[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-3-bromo-2-chloro-6-ethoxyphenoxy]acetonitrile |
|---|---|
| PubChem CID | 126292272 |
| Molecular Formula | C27H18BrClN4O4 |
| Molecular Weight | 577.82 g/mol |
| Exact Mass | 576.02 |
| IUPAC Name | 2-[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-3-bromo-2-chloro-6-ethoxyphenoxy]acetonitrile |
| SMILES | CCOc1cc(C=Nn2c(-c3cc4ccccc4o3)nc3ccccc3c2=O)c(Br)c(Cl)c1OCC#N |
| InChI | InChI=1S/C27H18BrClN4O4/c1-2-35-21-14-17(23(28)24(29)25(21)36-12-11-30)15-31-33-26(22-13-16-7-3-6-10-20(16)37-22)32-19-9-5-4-8-18(19)27(33)34/h3-10,13-15H,2,12H2,1H3 |
| InChIKey | YRPMQFFPEVFNGT-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 102.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.82 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|