C33H22ClIN4O4 — CID 126302013
2-[[4-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-ethoxy-6-iodophenoxy]methyl]benzonitrile (PubChem CID 126302013) has the molecular formula C33H22ClIN4O4 and a molecular weight of 700.92 g/mol. Its IUPAC name is 2-[[4-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-ethoxy-6-iodophenoxy]methyl]benzonitrile.
| Compound Name | 2-[[4-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-ethoxy-6-iodophenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126302013 |
| Molecular Formula | C33H22ClIN4O4 |
| Molecular Weight | 700.92 g/mol |
| Exact Mass | 700.04 |
| IUPAC Name | 2-[[4-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-ethoxy-6-iodophenoxy]methyl]benzonitrile |
| SMILES | CCOc1cc(C=Nn2c(-c3cc4cc(Cl)ccc4o3)nc3ccccc3c2=O)cc(I)c1OCc1ccccc1C#N |
| InChI | InChI=1S/C33H22ClIN4O4/c1-2-41-29-14-20(13-26(35)31(29)42-19-22-8-4-3-7-21(22)17-36)18-37-39-32(38-27-10-6-5-9-25(27)33(39)40)30-16-23-15-24(34)11-12-28(23)43-30/h3-16,18H,2,19H2,1H3 |
| InChIKey | GHVDTBNUKBJQPW-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 102.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.92 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|