C30H16Cl3I2N3O3 — CID 126314218
2-(5-chloro-1-benzofuran-2-yl)-3-[[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]quinazolin-4-one (PubChem CID 126314218) has the molecular formula C30H16Cl3I2N3O3 and a molecular weight of 826.64 g/mol. Its IUPAC name is 2-(5-chloro-1-benzofuran-2-yl)-3-[[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-(5-chloro-1-benzofuran-2-yl)-3-[[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126314218 |
| Molecular Formula | C30H16Cl3I2N3O3 |
| Molecular Weight | 826.64 g/mol |
| Exact Mass | 824.83 |
| IUPAC Name | 2-(5-chloro-1-benzofuran-2-yl)-3-[[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(-c2cc3cc(Cl)ccc3o2)n1N=Cc1cc(I)c(OCc2ccc(Cl)cc2Cl)c(I)c1 |
| InChI | InChI=1S/C30H16Cl3I2N3O3/c31-19-7-8-26-18(11-19)12-27(41-26)29-37-25-4-2-1-3-21(25)30(39)38(29)36-14-16-9-23(34)28(24(35)10-16)40-15-17-5-6-20(32)13-22(17)33/h1-14H,15H2 |
| InChIKey | WAXGAYKSXPYBQT-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 69.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.64 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|