C29H21Br2N3O3 — CID 126407145
3-[[4-[(2,4-dibromophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-2-phenylquinazolin-4-one (PubChem CID 126407145) has the molecular formula C29H21Br2N3O3 and a molecular weight of 619.31 g/mol. Its IUPAC name is 3-[[4-[(2,4-dibromophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-2-phenylquinazolin-4-one.
| Compound Name | 3-[[4-[(2,4-dibromophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-2-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 126407145 |
| Molecular Formula | C29H21Br2N3O3 |
| Molecular Weight | 619.31 g/mol |
| Exact Mass | 616.99 |
| IUPAC Name | 3-[[4-[(2,4-dibromophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-2-phenylquinazolin-4-one |
| SMILES | COc1cc(C=Nn2c(-c3ccccc3)nc3ccccc3c2=O)ccc1OCc1ccc(Br)cc1Br |
| InChI | InChI=1S/C29H21Br2N3O3/c1-36-27-15-19(11-14-26(27)37-18-21-12-13-22(30)16-24(21)31)17-32-34-28(20-7-3-2-4-8-20)33-25-10-6-5-9-23(25)29(34)35/h2-17H,18H2,1H3 |
| InChIKey | IPKCHWHKFNSYLO-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.31 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|