C32H28N4O5 — CID 126410864
2-[2,6-dimethoxy-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 126410864) has the molecular formula C32H28N4O5 and a molecular weight of 548.60 g/mol. Its IUPAC name is 2-[2,6-dimethoxy-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[2,6-dimethoxy-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126410864 |
| Molecular Formula | C32H28N4O5 |
| Molecular Weight | 548.60 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | 2-[2,6-dimethoxy-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | COc1cc(C=Nn2c(-c3ccccc3)nc3ccccc3c2=O)cc(OC)c1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C32H28N4O5/c1-21-13-15-24(16-14-21)34-29(37)20-41-30-27(39-2)17-22(18-28(30)40-3)19-33-36-31(23-9-5-4-6-10-23)35-26-12-8-7-11-25(26)32(36)38/h4-19H,20H2,1-3H3,(H,34,37) |
| InChIKey | QRJYFPWAVJMOIB-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 104.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.60 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|