C31H26N4O4 — CID 126407871
2-[2-methoxy-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]-N-(2-methylphenyl)acetamide (PubChem CID 126407871) has the molecular formula C31H26N4O4 and a molecular weight of 518.57 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[2-methoxy-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126407871 |
| Molecular Formula | C31H26N4O4 |
| Molecular Weight | 518.57 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | 2-[2-methoxy-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]-N-(2-methylphenyl)acetamide |
| SMILES | COc1cc(C=Nn2c(-c3ccccc3)nc3ccccc3c2=O)ccc1OCC(=O)Nc1ccccc1C |
| InChI | InChI=1S/C31H26N4O4/c1-21-10-6-8-14-25(21)33-29(36)20-39-27-17-16-22(18-28(27)38-2)19-32-35-30(23-11-4-3-5-12-23)34-26-15-9-7-13-24(26)31(35)37/h3-19H,20H2,1-2H3,(H,33,36) |
| InChIKey | LMLMIZRRJSKQOL-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 94.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.57 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|