C31H23F3N4O3 — CID 126300662
N-(2-methylphenyl)-2-[4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]acetamide (PubChem CID 126300662) has the molecular formula C31H23F3N4O3 and a molecular weight of 556.54 g/mol. Its IUPAC name is N-(2-methylphenyl)-2-[4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]acetamide.
| Compound Name | N-(2-methylphenyl)-2-[4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126300662 |
| Molecular Formula | C31H23F3N4O3 |
| Molecular Weight | 556.54 g/mol |
| Exact Mass | 556.17 |
| IUPAC Name | N-(2-methylphenyl)-2-[4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]acetamide |
| SMILES | Cc1ccccc1NC(=O)COc1ccc(C=Nn2c(-c3cccc(C(F)(F)F)c3)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C31H23F3N4O3/c1-20-7-2-4-11-26(20)36-28(39)19-41-24-15-13-21(14-16-24)18-35-38-29(22-8-6-9-23(17-22)31(32,33)34)37-27-12-5-3-10-25(27)30(38)40/h2-18H,19H2,1H3,(H,36,39) |
| InChIKey | MLHHCECMPHDJLP-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 85.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.54 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|