C28H23F3N4O4 — CID 126303040
3-[[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one (PubChem CID 126303040) has the molecular formula C28H23F3N4O4 and a molecular weight of 536.51 g/mol. Its IUPAC name is 3-[[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one.
| Compound Name | 3-[[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 126303040 |
| Molecular Formula | C28H23F3N4O4 |
| Molecular Weight | 536.51 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | 3-[[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
| SMILES | O=C(COc1ccc(C=Nn2c(-c3cccc(C(F)(F)F)c3)nc3ccccc3c2=O)cc1)N1CCOCC1 |
| InChI | InChI=1S/C28H23F3N4O4/c29-28(30,31)21-5-3-4-20(16-21)26-33-24-7-2-1-6-23(24)27(37)35(26)32-17-19-8-10-22(11-9-19)39-18-25(36)34-12-14-38-15-13-34/h1-11,16-17H,12-15,18H2 |
| InChIKey | RXXFEMPKPBGXOZ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 86.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.51 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|