C29H29BrN4O4 — CID 126289158
2-[4-[(6-bromo-2-tert-butyl-4-oxoquinazolin-3-yl)iminomethyl]-2-methoxyphenoxy]-N-(2-methylphenyl)acetamide (PubChem CID 126289158) has the molecular formula C29H29BrN4O4 and a molecular weight of 577.48 g/mol. Its IUPAC name is 2-[4-[(6-bromo-2-tert-butyl-4-oxoquinazolin-3-yl)iminomethyl]-2-methoxyphenoxy]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[4-[(6-bromo-2-tert-butyl-4-oxoquinazolin-3-yl)iminomethyl]-2-methoxyphenoxy]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126289158 |
| Molecular Formula | C29H29BrN4O4 |
| Molecular Weight | 577.48 g/mol |
| Exact Mass | 576.14 |
| IUPAC Name | 2-[4-[(6-bromo-2-tert-butyl-4-oxoquinazolin-3-yl)iminomethyl]-2-methoxyphenoxy]-N-(2-methylphenyl)acetamide |
| SMILES | COc1cc(C=Nn2c(C(C)(C)C)nc3ccc(Br)cc3c2=O)ccc1OCC(=O)Nc1ccccc1C |
| InChI | InChI=1S/C29H29BrN4O4/c1-18-8-6-7-9-22(18)32-26(35)17-38-24-13-10-19(14-25(24)37-5)16-31-34-27(36)21-15-20(30)11-12-23(21)33-28(34)29(2,3)4/h6-16H,17H2,1-5H3,(H,32,35) |
| InChIKey | QBRUGHSAVCVPLA-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 94.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.48 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|