C35H32N4O4 — CID 126409064
2-[2-ethoxy-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]-6-prop-2-enylphenoxy]-N-(2-methylphenyl)acetamide (PubChem CID 126409064) has the molecular formula C35H32N4O4 and a molecular weight of 572.67 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]-6-prop-2-enylphenoxy]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[2-ethoxy-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]-6-prop-2-enylphenoxy]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126409064 |
| Molecular Formula | C35H32N4O4 |
| Molecular Weight | 572.67 g/mol |
| Exact Mass | 572.24 |
| IUPAC Name | 2-[2-ethoxy-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]-6-prop-2-enylphenoxy]-N-(2-methylphenyl)acetamide |
| SMILES | C=CCc1cc(C=Nn2c(-c3ccccc3)nc3ccccc3c2=O)cc(OCC)c1OCC(=O)Nc1ccccc1C |
| InChI | InChI=1S/C35H32N4O4/c1-4-13-27-20-25(21-31(42-5-2)33(27)43-23-32(40)37-29-18-11-9-14-24(29)3)22-36-39-34(26-15-7-6-8-16-26)38-30-19-12-10-17-28(30)35(39)41/h4,6-12,14-22H,1,5,13,23H2,2-3H3,(H,37,40) |
| InChIKey | QEYJFBSWYUXYLR-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 94.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.67 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|