C34H28N4O6 — CID 126304631
2-[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2,6-dimethoxyphenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 126304631) has the molecular formula C34H28N4O6 and a molecular weight of 588.62 g/mol. Its IUPAC name is 2-[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2,6-dimethoxyphenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2,6-dimethoxyphenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126304631 |
| Molecular Formula | C34H28N4O6 |
| Molecular Weight | 588.62 g/mol |
| Exact Mass | 588.20 |
| IUPAC Name | 2-[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2,6-dimethoxyphenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | COc1cc(C=Nn2c(-c3cc4ccccc4o3)nc3ccccc3c2=O)cc(OC)c1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C34H28N4O6/c1-21-12-14-24(15-13-21)36-31(39)20-43-32-28(41-2)16-22(17-29(32)42-3)19-35-38-33(30-18-23-8-4-7-11-27(23)44-30)37-26-10-6-5-9-25(26)34(38)40/h4-19H,20H2,1-3H3,(H,36,39) |
| InChIKey | XASAKTIGKRWFOY-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 117.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.62 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|