C29H26FN5O5 — CID 126284814
2-[2-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-4-nitrophenoxy]-N-(3-fluorophenyl)acetamide (PubChem CID 126284814) has the molecular formula C29H26FN5O5 and a molecular weight of 543.56 g/mol. Its IUPAC name is 2-[2-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-4-nitrophenoxy]-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-[2-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-4-nitrophenoxy]-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126284814 |
| Molecular Formula | C29H26FN5O5 |
| Molecular Weight | 543.56 g/mol |
| Exact Mass | 543.19 |
| IUPAC Name | 2-[2-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-4-nitrophenoxy]-N-(3-fluorophenyl)acetamide |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1C=Nn1c(C2CCCCC2)nc2ccccc2c1=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C29H26FN5O5/c30-21-9-6-10-22(16-21)32-27(36)18-40-26-14-13-23(35(38)39)15-20(26)17-31-34-28(19-7-2-1-3-8-19)33-25-12-5-4-11-24(25)29(34)37/h4-6,9-17,19H,1-3,7-8,18H2,(H,32,36) |
| InChIKey | FJNGZPABDUXKRM-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 128.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.56 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|