C22H20F3N3O — CID 126289240
2-cyclohexyl-3-[[3-(trifluoromethyl)phenyl]methylideneamino]quinazolin-4-one (PubChem CID 126289240) has the molecular formula C22H20F3N3O and a molecular weight of 399.42 g/mol. Its IUPAC name is 2-cyclohexyl-3-[[3-(trifluoromethyl)phenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-cyclohexyl-3-[[3-(trifluoromethyl)phenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126289240 |
| Molecular Formula | C22H20F3N3O |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 2-cyclohexyl-3-[[3-(trifluoromethyl)phenyl]methylideneamino]quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(C2CCCCC2)n1N=Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H20F3N3O/c23-22(24,25)17-10-6-7-15(13-17)14-26-28-20(16-8-2-1-3-9-16)27-19-12-5-4-11-18(19)21(28)29/h4-7,10-14,16H,1-3,8-9H2 |
| InChIKey | QJVBIKUUWAFYIM-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|