C25H27FN4O — CID 126310744
2-cyclohexyl-3-[(3-fluoro-4-pyrrolidin-1-ylphenyl)methylideneamino]quinazolin-4-one (PubChem CID 126310744) has the molecular formula C25H27FN4O and a molecular weight of 418.52 g/mol. Its IUPAC name is 2-cyclohexyl-3-[(3-fluoro-4-pyrrolidin-1-ylphenyl)methylideneamino]quinazolin-4-one.
| Compound Name | 2-cyclohexyl-3-[(3-fluoro-4-pyrrolidin-1-ylphenyl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126310744 |
| Molecular Formula | C25H27FN4O |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | 2-cyclohexyl-3-[(3-fluoro-4-pyrrolidin-1-ylphenyl)methylideneamino]quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(C2CCCCC2)n1N=Cc1ccc(N2CCCC2)c(F)c1 |
| InChI | InChI=1S/C25H27FN4O/c26-21-16-18(12-13-23(21)29-14-6-7-15-29)17-27-30-24(19-8-2-1-3-9-19)28-22-11-5-4-10-20(22)25(30)31/h4-5,10-13,16-17,19H,1-3,6-9,14-15H2 |
| InChIKey | LTGFEJRRLRXYCB-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|