C30H26Cl2N4O — CID 126312948
2-cyclohexyl-3-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]quinazolin-4-one (PubChem CID 126312948) has the molecular formula C30H26Cl2N4O and a molecular weight of 529.47 g/mol. Its IUPAC name is 2-cyclohexyl-3-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-cyclohexyl-3-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126312948 |
| Molecular Formula | C30H26Cl2N4O |
| Molecular Weight | 529.47 g/mol |
| Exact Mass | 528.15 |
| IUPAC Name | 2-cyclohexyl-3-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(C2CCCCC2)n1N=Cc1cn(Cc2ccc(Cl)cc2Cl)c2ccccc12 |
| InChI | InChI=1S/C30H26Cl2N4O/c31-23-15-14-21(26(32)16-23)18-35-19-22(24-10-5-7-13-28(24)35)17-33-36-29(20-8-2-1-3-9-20)34-27-12-6-4-11-25(27)30(36)37/h4-7,10-17,19-20H,1-3,8-9,18H2 |
| InChIKey | PYOQFRXMYIMADW-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 52.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.47 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|