C30H27BrCl2N4O3 — CID 126320406
2-[4-[(6-bromo-2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-2,6-dichlorophenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 126320406) has the molecular formula C30H27BrCl2N4O3 and a molecular weight of 642.38 g/mol. Its IUPAC name is 2-[4-[(6-bromo-2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-2,6-dichlorophenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[4-[(6-bromo-2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-2,6-dichlorophenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126320406 |
| Molecular Formula | C30H27BrCl2N4O3 |
| Molecular Weight | 642.38 g/mol |
| Exact Mass | 640.06 |
| IUPAC Name | 2-[4-[(6-bromo-2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-2,6-dichlorophenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)COc2c(Cl)cc(C=Nn3c(C4CCCCC4)nc4ccc(Br)cc4c3=O)cc2Cl)cc1 |
| InChI | InChI=1S/C30H27BrCl2N4O3/c1-18-7-10-22(11-8-18)35-27(38)17-40-28-24(32)13-19(14-25(28)33)16-34-37-29(20-5-3-2-4-6-20)36-26-12-9-21(31)15-23(26)30(37)39/h7-16,20H,2-6,17H2,1H3,(H,35,38) |
| InChIKey | FKFHYLSEAWDTIB-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 85.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.38 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|