C27H24BrN5O7 — CID 126342140
6-bromo-3-[[3-ethoxy-5-nitro-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-propylquinazolin-4-one (PubChem CID 126342140) has the molecular formula C27H24BrN5O7 and a molecular weight of 610.42 g/mol. Its IUPAC name is 6-bromo-3-[[3-ethoxy-5-nitro-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-propylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[3-ethoxy-5-nitro-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-propylquinazolin-4-one |
|---|---|
| PubChem CID | 126342140 |
| Molecular Formula | C27H24BrN5O7 |
| Molecular Weight | 610.42 g/mol |
| Exact Mass | 609.09 |
| IUPAC Name | 6-bromo-3-[[3-ethoxy-5-nitro-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-propylquinazolin-4-one |
| SMILES | CCCc1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(OCC)c(OCc2cccc([N+](=O)[O-])c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H24BrN5O7/c1-3-6-25-30-22-10-9-19(28)14-21(22)27(34)31(25)29-15-18-12-23(33(37)38)26(24(13-18)39-4-2)40-16-17-7-5-8-20(11-17)32(35)36/h5,7-15H,3-4,6,16H2,1-2H3 |
| InChIKey | ZRIHVIFUPXZHCK-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 151.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.42 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|