C25H19Br2ClN4O4 — CID 126330965
6-bromo-3-[[3-bromo-5-chloro-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-propylquinazolin-4-one (PubChem CID 126330965) has the molecular formula C25H19Br2ClN4O4 and a molecular weight of 634.71 g/mol. Its IUPAC name is 6-bromo-3-[[3-bromo-5-chloro-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-propylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[3-bromo-5-chloro-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-propylquinazolin-4-one |
|---|---|
| PubChem CID | 126330965 |
| Molecular Formula | C25H19Br2ClN4O4 |
| Molecular Weight | 634.71 g/mol |
| Exact Mass | 631.95 |
| IUPAC Name | 6-bromo-3-[[3-bromo-5-chloro-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-propylquinazolin-4-one |
| SMILES | CCCc1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(Cl)c(OCc2cccc([N+](=O)[O-])c2)c(Br)c1 |
| InChI | InChI=1S/C25H19Br2ClN4O4/c1-2-4-23-30-22-8-7-17(26)12-19(22)25(33)31(23)29-13-16-10-20(27)24(21(28)11-16)36-14-15-5-3-6-18(9-15)32(34)35/h3,5-13H,2,4,14H2,1H3 |
| InChIKey | VGLIANMTWPLWPD-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 99.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.71 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|