C24H17BrClN5O6 — CID 126303792
6-bromo-3-[[5-chloro-3-nitro-2-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-ethylquinazolin-4-one (PubChem CID 126303792) has the molecular formula C24H17BrClN5O6 and a molecular weight of 586.79 g/mol. Its IUPAC name is 6-bromo-3-[[5-chloro-3-nitro-2-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-ethylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[5-chloro-3-nitro-2-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-ethylquinazolin-4-one |
|---|---|
| PubChem CID | 126303792 |
| Molecular Formula | C24H17BrClN5O6 |
| Molecular Weight | 586.79 g/mol |
| Exact Mass | 585.01 |
| IUPAC Name | 6-bromo-3-[[5-chloro-3-nitro-2-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-ethylquinazolin-4-one |
| SMILES | CCc1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(Cl)cc([N+](=O)[O-])c1OCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H17BrClN5O6/c1-2-22-28-20-7-6-16(25)10-19(20)24(32)29(22)27-12-15-9-17(26)11-21(31(35)36)23(15)37-13-14-4-3-5-18(8-14)30(33)34/h3-12H,2,13H2,1H3 |
| InChIKey | ULOVAGBOBJRACW-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 142.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.79 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|