C25H18BrClN4O6 — CID 126313835
3-[[2-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-4-chloro-6-nitrophenoxy]methyl]benzoic acid (PubChem CID 126313835) has the molecular formula C25H18BrClN4O6 and a molecular weight of 585.80 g/mol. Its IUPAC name is 3-[[2-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-4-chloro-6-nitrophenoxy]methyl]benzoic acid.
| Compound Name | 3-[[2-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-4-chloro-6-nitrophenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126313835 |
| Molecular Formula | C25H18BrClN4O6 |
| Molecular Weight | 585.80 g/mol |
| Exact Mass | 584.01 |
| IUPAC Name | 3-[[2-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-4-chloro-6-nitrophenoxy]methyl]benzoic acid |
| SMILES | CCc1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(Cl)cc([N+](=O)[O-])c1OCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C25H18BrClN4O6/c1-2-22-29-20-7-6-17(26)10-19(20)24(32)30(22)28-12-16-9-18(27)11-21(31(35)36)23(16)37-13-14-4-3-5-15(8-14)25(33)34/h3-12H,2,13H2,1H3,(H,33,34) |
| InChIKey | UOLXHFCGSYHEHV-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 136.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.80 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|