C20H16BrClN4O6 — CID 126298711
methyl 2-[2-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-4-chloro-6-nitrophenoxy]acetate (PubChem CID 126298711) has the molecular formula C20H16BrClN4O6 and a molecular weight of 523.73 g/mol. Its IUPAC name is methyl 2-[2-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-4-chloro-6-nitrophenoxy]acetate.
| Compound Name | methyl 2-[2-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-4-chloro-6-nitrophenoxy]acetate |
|---|---|
| PubChem CID | 126298711 |
| Molecular Formula | C20H16BrClN4O6 |
| Molecular Weight | 523.73 g/mol |
| Exact Mass | 521.99 |
| IUPAC Name | methyl 2-[2-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-4-chloro-6-nitrophenoxy]acetate |
| SMILES | CCc1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(Cl)cc([N+](=O)[O-])c1OCC(=O)OC |
| InChI | InChI=1S/C20H16BrClN4O6/c1-3-17-24-15-5-4-12(21)7-14(15)20(28)25(17)23-9-11-6-13(22)8-16(26(29)30)19(11)32-10-18(27)31-2/h4-9H,3,10H2,1-2H3 |
| InChIKey | HCKVZSAEIQMUBZ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 125.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.73 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|