C23H23BrN4O7 — CID 126301474
propan-2-yl 2-[4-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-2-ethoxy-6-nitrophenoxy]acetate (PubChem CID 126301474) has the molecular formula C23H23BrN4O7 and a molecular weight of 547.36 g/mol. Its IUPAC name is propan-2-yl 2-[4-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-2-ethoxy-6-nitrophenoxy]acetate.
| Compound Name | propan-2-yl 2-[4-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-2-ethoxy-6-nitrophenoxy]acetate |
|---|---|
| PubChem CID | 126301474 |
| Molecular Formula | C23H23BrN4O7 |
| Molecular Weight | 547.36 g/mol |
| Exact Mass | 546.08 |
| IUPAC Name | propan-2-yl 2-[4-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-2-ethoxy-6-nitrophenoxy]acetate |
| SMILES | CCOc1cc(C=Nn2c(C)nc3ccc(Br)cc3c2=O)cc([N+](=O)[O-])c1OCC(=O)OC(C)C |
| InChI | InChI=1S/C23H23BrN4O7/c1-5-33-20-9-15(8-19(28(31)32)22(20)34-12-21(29)35-13(2)3)11-25-27-14(4)26-18-7-6-16(24)10-17(18)23(27)30/h6-11,13H,5,12H2,1-4H3 |
| InChIKey | DQZCKQVMHWHFEG-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 135.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.36 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|