C22H23BrN4O5 — CID 126287376
6-bromo-3-[[4-[(2R)-butan-2-yl]oxy-3-ethoxy-5-nitrophenyl]methylideneamino]-2-methylquinazolin-4-one (PubChem CID 126287376) has the molecular formula C22H23BrN4O5 and a molecular weight of 503.35 g/mol. Its IUPAC name is 6-bromo-3-[[4-[(2R)-butan-2-yl]oxy-3-ethoxy-5-nitrophenyl]methylideneamino]-2-methylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[4-[(2R)-butan-2-yl]oxy-3-ethoxy-5-nitrophenyl]methylideneamino]-2-methylquinazolin-4-one |
|---|---|
| PubChem CID | 126287376 |
| Molecular Formula | C22H23BrN4O5 |
| Molecular Weight | 503.35 g/mol |
| Exact Mass | 502.09 |
| IUPAC Name | 6-bromo-3-[[4-[(2R)-butan-2-yl]oxy-3-ethoxy-5-nitrophenyl]methylideneamino]-2-methylquinazolin-4-one |
| SMILES | CCOc1cc(C=Nn2c(C)nc3ccc(Br)cc3c2=O)cc([N+](=O)[O-])c1O[C@H](C)CC |
| InChI | InChI=1S/C22H23BrN4O5/c1-5-13(3)32-21-19(27(29)30)9-15(10-20(21)31-6-2)12-24-26-14(4)25-18-8-7-16(23)11-17(18)22(26)28/h7-13H,5-6H2,1-4H3/t13-/m1/s1 |
| InChIKey | MAMWBHILQNBKJL-CYBMUJFWSA-N |
| XLogP | 4.83 |
| TPSA | 108.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.35 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|