C20H23BrN4O — CID 126330407
6-bromo-2-butyl-3-[(1,2,5-trimethylpyrrol-3-yl)methylideneamino]quinazolin-4-one (PubChem CID 126330407) has the molecular formula C20H23BrN4O and a molecular weight of 415.34 g/mol. Its IUPAC name is 6-bromo-2-butyl-3-[(1,2,5-trimethylpyrrol-3-yl)methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-butyl-3-[(1,2,5-trimethylpyrrol-3-yl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126330407 |
| Molecular Formula | C20H23BrN4O |
| Molecular Weight | 415.34 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | 6-bromo-2-butyl-3-[(1,2,5-trimethylpyrrol-3-yl)methylideneamino]quinazolin-4-one |
| SMILES | CCCCc1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(C)n(C)c1C |
| InChI | InChI=1S/C20H23BrN4O/c1-5-6-7-19-23-18-9-8-16(21)11-17(18)20(26)25(19)22-12-15-10-13(2)24(4)14(15)3/h8-12H,5-7H2,1-4H3 |
| InChIKey | STFHLCOKIWIECU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 52.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.34 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|