C27H29BrN4O — CID 126333704
6-bromo-2-butyl-3-[[1-(2,3-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]quinazolin-4-one (PubChem CID 126333704) has the molecular formula C27H29BrN4O and a molecular weight of 505.46 g/mol. Its IUPAC name is 6-bromo-2-butyl-3-[[1-(2,3-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-butyl-3-[[1-(2,3-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126333704 |
| Molecular Formula | C27H29BrN4O |
| Molecular Weight | 505.46 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | 6-bromo-2-butyl-3-[[1-(2,3-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]quinazolin-4-one |
| SMILES | CCCCc1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(C)n(-c2cccc(C)c2C)c1C |
| InChI | InChI=1S/C27H29BrN4O/c1-6-7-11-26-30-24-13-12-22(28)15-23(24)27(33)32(26)29-16-21-14-18(3)31(20(21)5)25-10-8-9-17(2)19(25)4/h8-10,12-16H,6-7,11H2,1-5H3 |
| InChIKey | VAUNZXWKTGBYAP-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 52.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.46 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|