C29H27BrN4O — CID 126336581
6-bromo-2-[(2R)-butan-2-yl]-3-[(2,5-dimethyl-1-naphthalen-1-ylpyrrol-3-yl)methylideneamino]quinazolin-4-one (PubChem CID 126336581) has the molecular formula C29H27BrN4O and a molecular weight of 527.47 g/mol. Its IUPAC name is 6-bromo-2-[(2R)-butan-2-yl]-3-[(2,5-dimethyl-1-naphthalen-1-ylpyrrol-3-yl)methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-[(2R)-butan-2-yl]-3-[(2,5-dimethyl-1-naphthalen-1-ylpyrrol-3-yl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126336581 |
| Molecular Formula | C29H27BrN4O |
| Molecular Weight | 527.47 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | 6-bromo-2-[(2R)-butan-2-yl]-3-[(2,5-dimethyl-1-naphthalen-1-ylpyrrol-3-yl)methylideneamino]quinazolin-4-one |
| SMILES | CC[C@@H](C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(C)n(-c2cccc3ccccc23)c1C |
| InChI | InChI=1S/C29H27BrN4O/c1-5-18(2)28-32-26-14-13-23(30)16-25(26)29(35)34(28)31-17-22-15-19(3)33(20(22)4)27-12-8-10-21-9-6-7-11-24(21)27/h6-18H,5H2,1-4H3/t18-/m1/s1 |
| InChIKey | AFUHVJMDAZLLDE-GOSISDBHSA-N |
| XLogP | 7.12 |
| TPSA | 52.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.47 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|