C25H26BrN5O — CID 126322239
6-bromo-2-[(2S)-butan-2-yl]-3-[[2,5-dimethyl-1-(4-methyl-2-pyridinyl)pyrrol-3-yl]methylideneamino]quinazolin-4-one (PubChem CID 126322239) has the molecular formula C25H26BrN5O and a molecular weight of 492.42 g/mol. Its IUPAC name is 6-bromo-2-[(2S)-butan-2-yl]-3-[[2,5-dimethyl-1-(4-methyl-2-pyridinyl)pyrrol-3-yl]methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-[(2S)-butan-2-yl]-3-[[2,5-dimethyl-1-(4-methyl-2-pyridinyl)pyrrol-3-yl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126322239 |
| Molecular Formula | C25H26BrN5O |
| Molecular Weight | 492.42 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | 6-bromo-2-[(2S)-butan-2-yl]-3-[[2,5-dimethyl-1-(4-methyl-2-pyridinyl)pyrrol-3-yl]methylideneamino]quinazolin-4-one |
| SMILES | CC[C@H](C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(C)n(-c2cc(C)ccn2)c1C |
| InChI | InChI=1S/C25H26BrN5O/c1-6-16(3)24-29-22-8-7-20(26)13-21(22)25(32)31(24)28-14-19-12-17(4)30(18(19)5)23-11-15(2)9-10-27-23/h7-14,16H,6H2,1-5H3/t16-/m0/s1 |
| InChIKey | LISKIWCYXUWZQR-INIZCTEOSA-N |
| XLogP | 5.67 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.42 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|