C31H26BrN5O2 — CID 126284405
2-[[4-[3-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-2,5-dimethylpyrrol-1-yl]phenoxy]methyl]benzonitrile (PubChem CID 126284405) has the molecular formula C31H26BrN5O2 and a molecular weight of 580.49 g/mol. Its IUPAC name is 2-[[4-[3-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-2,5-dimethylpyrrol-1-yl]phenoxy]methyl]benzonitrile.
| Compound Name | 2-[[4-[3-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-2,5-dimethylpyrrol-1-yl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126284405 |
| Molecular Formula | C31H26BrN5O2 |
| Molecular Weight | 580.49 g/mol |
| Exact Mass | 579.13 |
| IUPAC Name | 2-[[4-[3-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-2,5-dimethylpyrrol-1-yl]phenoxy]methyl]benzonitrile |
| SMILES | CCc1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(C)n(-c2ccc(OCc3ccccc3C#N)cc2)c1C |
| InChI | InChI=1S/C31H26BrN5O2/c1-4-30-35-29-14-9-25(32)16-28(29)31(38)37(30)34-18-24-15-20(2)36(21(24)3)26-10-12-27(13-11-26)39-19-23-8-6-5-7-22(23)17-33/h5-16,18H,4,19H2,1-3H3 |
| InChIKey | FDGAUDGPXVNSIX-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 85.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.49 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|