C32H24BrN3O5 — CID 126298895
2-(1-benzofuran-2-yl)-3-[[4-[(4-bromophenyl)methoxy]-3,5-dimethoxyphenyl]methylideneamino]quinazolin-4-one (PubChem CID 126298895) has the molecular formula C32H24BrN3O5 and a molecular weight of 610.46 g/mol. Its IUPAC name is 2-(1-benzofuran-2-yl)-3-[[4-[(4-bromophenyl)methoxy]-3,5-dimethoxyphenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-(1-benzofuran-2-yl)-3-[[4-[(4-bromophenyl)methoxy]-3,5-dimethoxyphenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126298895 |
| Molecular Formula | C32H24BrN3O5 |
| Molecular Weight | 610.46 g/mol |
| Exact Mass | 609.09 |
| IUPAC Name | 2-(1-benzofuran-2-yl)-3-[[4-[(4-bromophenyl)methoxy]-3,5-dimethoxyphenyl]methylideneamino]quinazolin-4-one |
| SMILES | COc1cc(C=Nn2c(-c3cc4ccccc4o3)nc3ccccc3c2=O)cc(OC)c1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C32H24BrN3O5/c1-38-27-15-21(16-28(39-2)30(27)40-19-20-11-13-23(33)14-12-20)18-34-36-31(29-17-22-7-3-6-10-26(22)41-29)35-25-9-5-4-8-24(25)32(36)37/h3-18H,19H2,1-2H3 |
| InChIKey | VANPXVSCJQULGU-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 88.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.46 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|