C31H21FIN3O4 — CID 126294135
2-(1-benzofuran-2-yl)-3-[[4-[(4-fluorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]quinazolin-4-one (PubChem CID 126294135) has the molecular formula C31H21FIN3O4 and a molecular weight of 645.43 g/mol. Its IUPAC name is 2-(1-benzofuran-2-yl)-3-[[4-[(4-fluorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-(1-benzofuran-2-yl)-3-[[4-[(4-fluorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126294135 |
| Molecular Formula | C31H21FIN3O4 |
| Molecular Weight | 645.43 g/mol |
| Exact Mass | 645.06 |
| IUPAC Name | 2-(1-benzofuran-2-yl)-3-[[4-[(4-fluorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]quinazolin-4-one |
| SMILES | COc1cc(C=Nn2c(-c3cc4ccccc4o3)nc3ccccc3c2=O)cc(I)c1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C31H21FIN3O4/c1-38-27-15-20(14-24(33)29(27)39-18-19-10-12-22(32)13-11-19)17-34-36-30(28-16-21-6-2-5-9-26(21)40-28)35-25-8-4-3-7-23(25)31(36)37/h2-17H,18H2,1H3 |
| InChIKey | BKEGAPHFUMOROB-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 78.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.43 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|