C36H26ClN3O4 — CID 126300308
2-(1-benzofuran-2-yl)-3-[[3-chloro-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]quinazolin-4-one (PubChem CID 126300308) has the molecular formula C36H26ClN3O4 and a molecular weight of 600.07 g/mol. Its IUPAC name is 2-(1-benzofuran-2-yl)-3-[[3-chloro-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-(1-benzofuran-2-yl)-3-[[3-chloro-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126300308 |
| Molecular Formula | C36H26ClN3O4 |
| Molecular Weight | 600.07 g/mol |
| Exact Mass | 599.16 |
| IUPAC Name | 2-(1-benzofuran-2-yl)-3-[[3-chloro-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]quinazolin-4-one |
| SMILES | CCOc1cc(C=Nn2c(-c3cc4ccccc4o3)nc3ccccc3c2=O)cc(Cl)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C36H26ClN3O4/c1-2-42-32-19-23(18-29(37)34(32)43-22-26-13-9-12-24-10-3-5-14-27(24)26)21-38-40-35(33-20-25-11-4-8-17-31(25)44-33)39-30-16-7-6-15-28(30)36(40)41/h3-21H,2,22H2,1H3 |
| InChIKey | NWTNRMRXQJGDLB-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 78.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.07 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|