C30H27BrIN3O4 — CID 126294333
2-(5-bromo-1-benzofuran-2-yl)-3-[[4-(2,2-dimethylpropoxy)-3-ethoxy-5-iodophenyl]methylideneamino]quinazolin-4-one (PubChem CID 126294333) has the molecular formula C30H27BrIN3O4 and a molecular weight of 700.37 g/mol. Its IUPAC name is 2-(5-bromo-1-benzofuran-2-yl)-3-[[4-(2,2-dimethylpropoxy)-3-ethoxy-5-iodophenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-(5-bromo-1-benzofuran-2-yl)-3-[[4-(2,2-dimethylpropoxy)-3-ethoxy-5-iodophenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126294333 |
| Molecular Formula | C30H27BrIN3O4 |
| Molecular Weight | 700.37 g/mol |
| Exact Mass | 699.02 |
| IUPAC Name | 2-(5-bromo-1-benzofuran-2-yl)-3-[[4-(2,2-dimethylpropoxy)-3-ethoxy-5-iodophenyl]methylideneamino]quinazolin-4-one |
| SMILES | CCOc1cc(C=Nn2c(-c3cc4cc(Br)ccc4o3)nc3ccccc3c2=O)cc(I)c1OCC(C)(C)C |
| InChI | InChI=1S/C30H27BrIN3O4/c1-5-37-25-13-18(12-22(32)27(25)38-17-30(2,3)4)16-33-35-28(34-23-9-7-6-8-21(23)29(35)36)26-15-19-14-20(31)10-11-24(19)39-26/h6-16H,5,17H2,1-4H3 |
| InChIKey | DNRHPKHIKWFMPT-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 78.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.37 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|