C30H16Br2Cl2N4O5 — CID 126286207
2-(5-bromo-1-benzofuran-2-yl)-3-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]-3-nitrophenyl]methylideneamino]quinazolin-4-one (PubChem CID 126286207) has the molecular formula C30H16Br2Cl2N4O5 and a molecular weight of 743.20 g/mol. Its IUPAC name is 2-(5-bromo-1-benzofuran-2-yl)-3-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]-3-nitrophenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-(5-bromo-1-benzofuran-2-yl)-3-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]-3-nitrophenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126286207 |
| Molecular Formula | C30H16Br2Cl2N4O5 |
| Molecular Weight | 743.20 g/mol |
| Exact Mass | 739.89 |
| IUPAC Name | 2-(5-bromo-1-benzofuran-2-yl)-3-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]-3-nitrophenyl]methylideneamino]quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(-c2cc3cc(Br)ccc3o2)n1N=Cc1cc(Br)cc([N+](=O)[O-])c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C30H16Br2Cl2N4O5/c31-19-6-8-26-17(9-19)11-27(43-26)29-36-24-4-2-1-3-22(24)30(39)37(29)35-14-18-10-20(32)12-25(38(40)41)28(18)42-15-16-5-7-21(33)13-23(16)34/h1-14H,15H2 |
| InChIKey | IIVMELVXOFFRBM-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 112.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.20 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|