C29H19I2N3O4 — CID 126409517
3-[[2,6-diiodo-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]methyl]benzoic acid (PubChem CID 126409517) has the molecular formula C29H19I2N3O4 and a molecular weight of 727.30 g/mol. Its IUPAC name is 3-[[2,6-diiodo-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]methyl]benzoic acid.
| Compound Name | 3-[[2,6-diiodo-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126409517 |
| Molecular Formula | C29H19I2N3O4 |
| Molecular Weight | 727.30 g/mol |
| Exact Mass | 726.95 |
| IUPAC Name | 3-[[2,6-diiodo-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(COc2c(I)cc(C=Nn3c(-c4ccccc4)nc4ccccc4c3=O)cc2I)c1 |
| InChI | InChI=1S/C29H19I2N3O4/c30-23-14-19(15-24(31)26(23)38-17-18-7-6-10-21(13-18)29(36)37)16-32-34-27(20-8-2-1-3-9-20)33-25-12-5-4-11-22(25)28(34)35/h1-16H,17H2,(H,36,37) |
| InChIKey | SMOGWSUDTFMGTE-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.30 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|