C28H19FIN3O2 — CID 126410546
3-[[4-[(3-fluorophenyl)methoxy]-3-iodophenyl]methylideneamino]-2-phenylquinazolin-4-one (PubChem CID 126410546) has the molecular formula C28H19FIN3O2 and a molecular weight of 575.38 g/mol. Its IUPAC name is 3-[[4-[(3-fluorophenyl)methoxy]-3-iodophenyl]methylideneamino]-2-phenylquinazolin-4-one.
| Compound Name | 3-[[4-[(3-fluorophenyl)methoxy]-3-iodophenyl]methylideneamino]-2-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 126410546 |
| Molecular Formula | C28H19FIN3O2 |
| Molecular Weight | 575.38 g/mol |
| Exact Mass | 575.05 |
| IUPAC Name | 3-[[4-[(3-fluorophenyl)methoxy]-3-iodophenyl]methylideneamino]-2-phenylquinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(-c2ccccc2)n1N=Cc1ccc(OCc2cccc(F)c2)c(I)c1 |
| InChI | InChI=1S/C28H19FIN3O2/c29-22-10-6-7-20(15-22)18-35-26-14-13-19(16-24(26)30)17-31-33-27(21-8-2-1-3-9-21)32-25-12-5-4-11-23(25)28(33)34/h1-17H,18H2 |
| InChIKey | WHGAVESCCLBOEK-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.38 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|