C17H17NO3 — CID 129451063
[4-[(E)-hydroxyiminomethyl]-2,6-dimethylphenyl] 3-methylbenzoate (PubChem CID 129451063) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is [4-[(E)-hydroxyiminomethyl]-2,6-dimethylphenyl] 3-methylbenzoate.
| Compound Name | [4-[(E)-hydroxyiminomethyl]-2,6-dimethylphenyl] 3-methylbenzoate |
|---|---|
| PubChem CID | 129451063 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | [4-[(E)-hydroxyiminomethyl]-2,6-dimethylphenyl] 3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)Oc2c(C)cc(/C=N/O)cc2C)c1 |
| InChI | InChI=1S/C17H17NO3/c1-11-5-4-6-15(7-11)17(19)21-16-12(2)8-14(10-18-20)9-13(16)3/h4-10,20H,1-3H3/b18-10+ |
| InChIKey | GJEMCJKICBRXBL-VCHYOVAHSA-N |
| XLogP | 3.64 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|